Products 2125943-72-6

CAS 2125943-72-6 is the registry number for 2-((Ethylthio)carbonyl)-5-oxo-1-pyrrolidinecarboxylic Acid tert-Butyl Ester. Offered by: TRC. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate (CAS 2125943-72-6) is a chemical compound with the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. IUPAC name: tert-butyl 2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate. InChIKey: DKQDRVXNPGKIGU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO4S
Molecular weight273.35 g/mol
IUPAC nametert-butyl 2-ethylsulfanylcarbonyl-5-oxopyrrolidine-1-carboxylate
InChIKeyDKQDRVXNPGKIGU-UHFFFAOYSA-N
SMILESCCSC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)