CAS 942771-71-3 is the registry number for N-(1-Hydroxybutan-2-yl)-2-methoxy-5-methylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1-hydroxybutan-2-yl)-2-methoxy-5-methylbenzenesulfonamide (CAS 942771-71-3) is a chemical compound with the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. IUPAC name: N-(1-hydroxybutan-2-yl)-2-methoxy-5-methylbenzenesulfonamide. InChIKey: WFSSNTJEMBDLHI-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4S |
|---|---|
| Molecular weight | 273.35 g/mol |
| IUPAC name | N-(1-hydroxybutan-2-yl)-2-methoxy-5-methylbenzenesulfonamide |
| InChIKey | WFSSNTJEMBDLHI-UHFFFAOYSA-N |
| SMILES | CCC(CO)NS(=O)(=O)C1=C(C=CC(=C1)C)OC |
Computed by PubChem (NCBI)