CAS 885268-06-4 appears in our catalog under these names: 1-(4-Ethoxy-3-methoxyphenyl)-2-(methylsulfonyl)ethanamine, Apremilast Impurity 29. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethanamine (CAS 885268-06-4) is a chemical compound with the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. IUPAC name: 1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethanamine. InChIKey: GQCGKOCDUDCTJT-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4S |
|---|---|
| Molecular weight | 273.35 g/mol |
| IUPAC name | 1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethanamine |
| InChIKey | GQCGKOCDUDCTJT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(CS(=O)(=O)C)N)OC |
Computed by PubChem (NCBI)