Products 2125994-25-2

CAS 2125994-25-2 is the registry number for Bupivacaine Impurity 10. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-butan-2-yl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide (CAS 2125994-25-2) is a chemical compound with the molecular formula C18H28N2O and a molecular weight of 288.4 g/mol. IUPAC name: 1-butan-2-yl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide. InChIKey: RTDIJAHGJUZJCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28N2O
Molecular weight288.4 g/mol
IUPAC name1-butan-2-yl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide
InChIKeyRTDIJAHGJUZJCJ-UHFFFAOYSA-N
SMILESCCC(C)N1CCCCC1C(=O)NC2=C(C=CC=C2C)C

Computed by PubChem (NCBI)