Products 474668-57-0
CAS 474668-57-0 appears in our catalog under these names: Bupivacaine-d9, (±)-Bupivacaine-d9 (butyl-d9), >95% (HPLC), (±)-Bupivacaine-d9 (butyl-d9), 98 atom % D, min 98% Chemical Purity, Bupivacaine–d9, Bupivacaine-d9, 99.04%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)piperidine-2-carboxamide (CAS 474668-57-0) is a chemical compound with the molecular formula C18H28N2O and a molecular weight of 297.5 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)piperidine-2-carboxamide. InChIKey: LEBVLXFERQHONN-JOJYFGIVSA-N.
| Molecular formula | C18H28N2O |
|---|---|
| Molecular weight | 297.5 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)piperidine-2-carboxamide |
| InChIKey | LEBVLXFERQHONN-JOJYFGIVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N1CCCCC1C(=O)NC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)