CAS 926913-58-8 is the registry number for Evercool 190, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
(1R,2S,5R)-5-methyl-2-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide (CAS 926913-58-8) is a chemical compound with the molecular formula C18H28N2O and a molecular weight of 288.4 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide. InChIKey: WXABJFUNSDXVNH-HYVNUMGLSA-N.
| Molecular formula | C18H28N2O |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide |
| InChIKey | WXABJFUNSDXVNH-HYVNUMGLSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)NCCC2=CC=CC=N2)C(C)C |
Computed by PubChem (NCBI)