Products 2129647-31-8
CAS 2129647-31-8 is the registry number for tert-Butyl 1,1-difluoro-5-azaspiro[2.3]hexane-5-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 2,2-difluoro-5-azaspiro[2.3]hexane-5-carboxylate (CAS 2129647-31-8) is a chemical compound with the molecular formula C10H15F2NO2 and a molecular weight of 219.23 g/mol. IUPAC name: tert-butyl 2,2-difluoro-5-azaspiro[2.3]hexane-5-carboxylate. InChIKey: AFOLBYXEJDSMHT-UHFFFAOYSA-N.
| Molecular formula | C10H15F2NO2 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | tert-butyl 2,2-difluoro-5-azaspiro[2.3]hexane-5-carboxylate |
| InChIKey | AFOLBYXEJDSMHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC2(F)F |
Computed by PubChem (NCBI)