CAS 2639378-59-7 is the registry number for rel-Methyl (3aS,7aS)-6,6-difluorooctahydro-3aH-isoindole-3a-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3aS,7aS)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindole-3a-carboxylate (CAS 2639378-59-7) is a chemical compound with the molecular formula C10H15F2NO2 and a molecular weight of 219.23 g/mol. IUPAC name: methyl (3aS,7aS)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindole-3a-carboxylate. InChIKey: COAQJSLDEDTYKM-VXNVDRBHSA-N.
| Molecular formula | C10H15F2NO2 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | methyl (3aS,7aS)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindole-3a-carboxylate |
| InChIKey | COAQJSLDEDTYKM-VXNVDRBHSA-N |
| SMILES | COC(=O)[C@@]12CCC(C[C@@H]1CNC2)(F)F |
Computed by PubChem (NCBI)