Products 2387594-62-7

CAS 2387594-62-7 is the registry number for 8,8-Difluoro-1-azaspiro[4.5]decane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

8,8-difluoro-1-azaspiro[4.5]decane-2-carboxylic acid (CAS 2387594-62-7) is a chemical compound with the molecular formula C10H15F2NO2 and a molecular weight of 219.23 g/mol. IUPAC name: 8,8-difluoro-1-azaspiro[4.5]decane-2-carboxylic acid. InChIKey: BSVMIEVZAKKZLF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15F2NO2
Molecular weight219.23 g/mol
IUPAC name8,8-difluoro-1-azaspiro[4.5]decane-2-carboxylic acid
InChIKeyBSVMIEVZAKKZLF-UHFFFAOYSA-N
SMILESC1CC2(CCC(CC2)(F)F)NC1C(=O)O

Computed by PubChem (NCBI)