Products 213113-12-3
CAS 213113-12-3 is the registry number for 2-Methoxy-5-[(1E)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (CAS 213113-12-3) is a chemical compound with the molecular formula C18H21NO4 and a molecular weight of 315.4 g/mol. IUPAC name: 2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline. InChIKey: QSAMWSFELUCKOA-AATRIKPKSA-N.
| Molecular formula | C18H21NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| InChIKey | QSAMWSFELUCKOA-AATRIKPKSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C2=CC(=C(C(=C2)OC)OC)OC)N |
Computed by PubChem (NCBI)