CAS 2133-03-1 is the registry number for Mesalamine Impurity 8 HCl (5-Hydroxyanthranilic Acid HCl). Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-hydroxybenzoic acid;hydrochloride (CAS 2133-03-1) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 2-amino-5-hydroxybenzoic acid;hydrochloride. InChIKey: LBPNOPBEVPRCKC-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3 |
|---|---|
| Molecular weight | 189.59 g/mol |
| IUPAC name | 2-amino-5-hydroxybenzoic acid;hydrochloride |
| InChIKey | LBPNOPBEVPRCKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)N.Cl |
Computed by PubChem (NCBI)