Products 213386-10-8
CAS 213386-10-8 appears in our catalog under these names: 3-Nitro-L-tyrosine-d3, >95% (HPLC), L-4-Hydroxy-3-nitrophenyl-2,5,6-d3-alanine, 98 atom % D, min 98% Chemical Purity, 3–Nitro–L–tyrosine–d3, 3-Nitro-L-tyrosine-d3, 99.9%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,01g, 0,005g, 1mg, 5mg, 5 mg.
(2S)-2-amino-3-(2,3,6-trideuterio-4-hydroxy-5-nitrophenyl)propanoic acid (CAS 213386-10-8) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 229.20 g/mol. IUPAC name: (2S)-2-amino-3-(2,3,6-trideuterio-4-hydroxy-5-nitrophenyl)propanoic acid. InChIKey: FBTSQILOGYXGMD-UOCCHMHCSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,3,6-trideuterio-4-hydroxy-5-nitrophenyl)propanoic acid |
| InChIKey | FBTSQILOGYXGMD-UOCCHMHCSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C[C@@H](C(=O)O)N)[2H])[N+](=O)[O-])O)[2H] |
Computed by PubChem (NCBI)