CAS 2135331-99-4 is the registry number for (R)-3-AMINO-1-ISOPROPYLPIPERIDIN-2-ONE HCL, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(3R)-3-amino-1-propan-2-ylpiperidin-2-one;hydrochloride (CAS 2135331-99-4) is a chemical compound with the molecular formula C8H17ClN2O and a molecular weight of 192.68 g/mol. IUPAC name: (3R)-3-amino-1-propan-2-ylpiperidin-2-one;hydrochloride. InChIKey: XMMCRTWUVLIWRD-OGFXRTJISA-N.
| Molecular formula | C8H17ClN2O |
|---|---|
| Molecular weight | 192.68 g/mol |
| IUPAC name | (3R)-3-amino-1-propan-2-ylpiperidin-2-one;hydrochloride |
| InChIKey | XMMCRTWUVLIWRD-OGFXRTJISA-N |
| SMILES | CC(C)N1CCC[C@H](C1=O)N.Cl |
Computed by PubChem (NCBI)