Products 213686-08-9
CAS 213686-08-9 is the registry number for (5R,2R)-2,5-Diaminoadipic acid 2HCl. Offered by: Creative Peptides. Available pack sizes: on request.
(2R,5R)-2,5-diaminohexanedioic acid (CAS 213686-08-9) is a chemical compound with the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. IUPAC name: (2R,5R)-2,5-diaminohexanedioic acid. InChIKey: KLNKMGPJWOMQTJ-QWWZWVQMSA-N.
| Molecular formula | C6H12N2O4 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (2R,5R)-2,5-diaminohexanedioic acid |
| InChIKey | KLNKMGPJWOMQTJ-QWWZWVQMSA-N |
| SMILES | C(C[C@H](C(=O)O)N)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(5R,2R)-2,5-Diaminoadipic acid 2HCl