CAS 27174-15-8 appears in our catalog under these names: Glycyl-dl-threonine hydrate, 95%, H–Gly–DL–Thr–OH, H-Gly-DL-Thr-OH, GLYCYL-DL-THREONINE HYDRATE. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
(2S,3R)-2-amino-3-(2-aminoacetyl)oxybutanoic acid (CAS 27174-15-8) is a chemical compound with the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. IUPAC name: (2S,3R)-2-amino-3-(2-aminoacetyl)oxybutanoic acid. InChIKey: MIYOEFIPPDFVIH-WUJLRWPWSA-N.
| Molecular formula | C6H12N2O4 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-(2-aminoacetyl)oxybutanoic acid |
| InChIKey | MIYOEFIPPDFVIH-WUJLRWPWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)OC(=O)CN |
Computed by PubChem (NCBI)