Products 374688-38-7
CAS 374688-38-7 is the registry number for (2-Deoxy-D-erythro-pentofuranosyl)-urea. Offered by: TRC. Available pack sizes: 25mg.
[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea (CAS 374688-38-7) is a chemical compound with the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. IUPAC name: [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea. InChIKey: QPADYGQDEFABBT-PYHARJCCSA-N.
| Molecular formula | C6H12N2O4 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
| InChIKey | QPADYGQDEFABBT-PYHARJCCSA-N |
| SMILES | C1[C@@H]([C@H](OC1NC(=O)N)CO)O |
Computed by PubChem (NCBI)