CAS 2137077-81-5 is the registry number for Ethyl (1S,3S,5S)-2-benzyl-2-azabicyclo(3.1.0)hexane-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 2137077-81-5) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: ethyl (1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: NWCKJHGNYVNTEH-IHRRRGAJSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | ethyl (1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | NWCKJHGNYVNTEH-IHRRRGAJSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2C[C@@H]2N1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)