CAS 2137086-32-7 is the registry number for 2-Methyl 1-prop-2-en-1-yl (2S)-aziridine-1,2-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-O-methyl 1-O-prop-2-enyl (2S)-aziridine-1,2-dicarboxylate (CAS 2137086-32-7) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: 2-O-methyl 1-O-prop-2-enyl (2S)-aziridine-1,2-dicarboxylate. InChIKey: JEZHDKNETSXTJZ-AADKRJSRSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 2-O-methyl 1-O-prop-2-enyl (2S)-aziridine-1,2-dicarboxylate |
| InChIKey | JEZHDKNETSXTJZ-AADKRJSRSA-N |
| SMILES | COC(=O)[C@@H]1CN1C(=O)OCC=C |
Computed by PubChem (NCBI)