Products 892128-58-4
CAS 892128-58-4 is the registry number for (2S,4S)-H-L-Pro(4-N3)-OH. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,4S)-4-azidopyrrolidine-2-carboxylic acid (CAS 892128-58-4) is a chemical compound with the molecular formula C5H8N4O2 and a molecular weight of 156.14 g/mol. IUPAC name: (2S,4S)-4-azidopyrrolidine-2-carboxylic acid. InChIKey: PPRFZPZRQYPCER-IMJSIDKUSA-N.
| Molecular formula | C5H8N4O2 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | (2S,4S)-4-azidopyrrolidine-2-carboxylic acid |
| InChIKey | PPRFZPZRQYPCER-IMJSIDKUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)