Products 2137536-34-4
CAS 2137536-34-4 is the registry number for 3-(3,3-Dimethylcyclohex-1-en-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3,3-dimethylcyclohexen-1-yl)aniline (CAS 2137536-34-4) is a chemical compound with the molecular formula C14H19N and a molecular weight of 201.31 g/mol. IUPAC name: 3-(3,3-dimethylcyclohexen-1-yl)aniline. InChIKey: RUAIXAXRDFBLDQ-UHFFFAOYSA-N.
| Molecular formula | C14H19N |
|---|---|
| Molecular weight | 201.31 g/mol |
| IUPAC name | 3-(3,3-dimethylcyclohexen-1-yl)aniline |
| InChIKey | RUAIXAXRDFBLDQ-UHFFFAOYSA-N |
| SMILES | CC1(CCCC(=C1)C2=CC(=CC=C2)N)C |
Computed by PubChem (NCBI)