CAS 2137549-20-1 is the registry number for 1-Cyclopropyl-N-methyl-1-phenylmethanesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-cyclopropyl-N-methyl-1-phenylmethanesulfonamide (CAS 2137549-20-1) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 1-cyclopropyl-N-methyl-1-phenylmethanesulfonamide. InChIKey: FCZLYNQWNDZYLC-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 1-cyclopropyl-N-methyl-1-phenylmethanesulfonamide |
| InChIKey | FCZLYNQWNDZYLC-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C(C1CC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)