CAS 2137606-47-2 appears in our catalog under these names: rel-(2S,4S)-Ethyl 4-aminotetrahydro-2H-pyran-2-carboxylate hydrochloride, 95%, rac-Ethyl (2R,4R)-4-aminooxane-2-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl (2S,4S)-4-aminooxane-2-carboxylate;hydrochloride (CAS 2137606-47-2) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: ethyl (2S,4S)-4-aminooxane-2-carboxylate;hydrochloride. InChIKey: CYBRKWBYDIDMGL-LEUCUCNGSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | ethyl (2S,4S)-4-aminooxane-2-carboxylate;hydrochloride |
| InChIKey | CYBRKWBYDIDMGL-LEUCUCNGSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H](CCO1)N.Cl |
Computed by PubChem (NCBI)