CAS 2940874-08-6 is the registry number for ethyl cis-4-aminotetrahydropyran-2-carboxylate,hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,4S)-4-aminooxane-2-carboxylate;hydrochloride (CAS 2940874-08-6) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: ethyl (2R,4S)-4-aminooxane-2-carboxylate;hydrochloride. InChIKey: CYBRKWBYDIDMGL-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | ethyl (2R,4S)-4-aminooxane-2-carboxylate;hydrochloride |
| InChIKey | CYBRKWBYDIDMGL-UOERWJHTSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@H](CCO1)N.Cl |
Computed by PubChem (NCBI)