CAS 2137620-06-3 appears in our catalog under these names: 5-Ethylpyridine-3-sulfonyl fluoride, 5-Ethylpyridine-3-sulfonyl fluoride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-ethylpyridine-3-sulfonyl fluoride (CAS 2137620-06-3) is a chemical compound with the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. IUPAC name: 5-ethylpyridine-3-sulfonyl fluoride. InChIKey: HGIOAVOSXGCZII-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO2S |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-ethylpyridine-3-sulfonyl fluoride |
| InChIKey | HGIOAVOSXGCZII-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CN=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)