Products 2137717-74-7
CAS 2137717-74-7 is the registry number for rac-(1R,6S)-2-Azabicyclo(4.1.0)heptane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,6R)-2-azabicyclo[4.1.0]heptane-1-carboxylic acid;hydrochloride (CAS 2137717-74-7) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1S,6R)-2-azabicyclo[4.1.0]heptane-1-carboxylic acid;hydrochloride. InChIKey: KMOPZLUEJMECES-PACXSXMQSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (1S,6R)-2-azabicyclo[4.1.0]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | KMOPZLUEJMECES-PACXSXMQSA-N |
| SMILES | C1C[C@@H]2C[C@@]2(NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)