Products 2137768-56-8

CAS 2137768-56-8 is the registry number for 1-tert-Butyl 3-chloromethyl pyrrolidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-(chloromethyl) pyrrolidine-1,3-dicarboxylate (CAS 2137768-56-8) is a chemical compound with the molecular formula C11H18ClNO4 and a molecular weight of 263.72 g/mol. IUPAC name: 1-O-tert-butyl 3-O-(chloromethyl) pyrrolidine-1,3-dicarboxylate. InChIKey: JFYZPGSWYSJESJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18ClNO4
Molecular weight263.72 g/mol
IUPAC name1-O-tert-butyl 3-O-(chloromethyl) pyrrolidine-1,3-dicarboxylate
InChIKeyJFYZPGSWYSJESJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C1)C(=O)OCCl

Computed by PubChem (NCBI)