Products 34614-72-7

CAS 34614-72-7 is the registry number for 1-tert-Butyl 2-chloromethyl (2s)-pyrrolidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-(chloromethyl) (2S)-pyrrolidine-1,2-dicarboxylate (CAS 34614-72-7) is a chemical compound with the molecular formula C11H18ClNO4 and a molecular weight of 263.72 g/mol. IUPAC name: 1-O-tert-butyl 2-O-(chloromethyl) (2S)-pyrrolidine-1,2-dicarboxylate. InChIKey: ZGBCOSGDWQPYHA-QMMMGPOBSA-N.

Identity
Molecular formulaC11H18ClNO4
Molecular weight263.72 g/mol
IUPAC name1-O-tert-butyl 2-O-(chloromethyl) (2S)-pyrrolidine-1,2-dicarboxylate
InChIKeyZGBCOSGDWQPYHA-QMMMGPOBSA-N
SMILESCC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCCl

Computed by PubChem (NCBI)