CAS 317356-97-1 appears in our catalog under these names: (2S,4R)-4-Chloro-pyrrolidine-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester, 95%, (2S,4R)-4-Chloro-pyrrolidine-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-chloropyrrolidine-1,2-dicarboxylate (CAS 317356-97-1) is a chemical compound with the molecular formula C11H18ClNO4 and a molecular weight of 263.72 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-chloropyrrolidine-1,2-dicarboxylate. InChIKey: XNKQYQOTERJNHJ-SFYZADRCSA-N.
| Molecular formula | C11H18ClNO4 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-chloropyrrolidine-1,2-dicarboxylate |
| InChIKey | XNKQYQOTERJNHJ-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)Cl |
Computed by PubChem (NCBI)