CAS 2137782-21-7 is the registry number for 2-(3-(Aminomethyl)benzenesulfonyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-(aminomethyl)phenyl]sulfonylethanol;hydrochloride (CAS 2137782-21-7) is a chemical compound with the molecular formula C9H14ClNO3S and a molecular weight of 251.73 g/mol. IUPAC name: 2-[3-(aminomethyl)phenyl]sulfonylethanol;hydrochloride. InChIKey: HDJNXDWBWRGRDG-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO3S |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | 2-[3-(aminomethyl)phenyl]sulfonylethanol;hydrochloride |
| InChIKey | HDJNXDWBWRGRDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)CCO)CN.Cl |
Computed by PubChem (NCBI)