CAS 855949-06-3 is the registry number for 4-(2-Methoxyethanesulfonyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2-methoxyethylsulfonyl)aniline;hydrochloride (CAS 855949-06-3) is a chemical compound with the molecular formula C9H14ClNO3S and a molecular weight of 251.73 g/mol. IUPAC name: 4-(2-methoxyethylsulfonyl)aniline;hydrochloride. InChIKey: MWGZDJIXRZLDNY-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO3S |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | 4-(2-methoxyethylsulfonyl)aniline;hydrochloride |
| InChIKey | MWGZDJIXRZLDNY-UHFFFAOYSA-N |
| SMILES | COCCS(=O)(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)