CAS 2554776-05-3 is the registry number for (S)–2–Amino–2–(3–(methylsulfonyl)phenyl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2S)-2-amino-2-(3-methylsulfonylphenyl)ethanol;hydrochloride (CAS 2554776-05-3) is a chemical compound with the molecular formula C9H14ClNO3S and a molecular weight of 251.73 g/mol. IUPAC name: (2S)-2-amino-2-(3-methylsulfonylphenyl)ethanol;hydrochloride. InChIKey: YTCSLMORNSCNKJ-SBSPUUFOSA-N.
| Molecular formula | C9H14ClNO3S |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-methylsulfonylphenyl)ethanol;hydrochloride |
| InChIKey | YTCSLMORNSCNKJ-SBSPUUFOSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)