Products 2137803-51-9

CAS 2137803-51-9 is the registry number for N-Fmoc-2-bromobenzylglycine, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-[(2-bromophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 2137803-51-9) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: 2-[(2-bromophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: QEGXPTMBSXIEJY-UHFFFAOYSA-N.

Identity
Molecular formulaC24H20BrNO4
Molecular weight466.3 g/mol
IUPAC name2-[(2-bromophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid
InChIKeyQEGXPTMBSXIEJY-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CN(CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Br

Computed by PubChem (NCBI)