Products 2137822-79-6
CAS 2137822-79-6 is the registry number for 5-Bromo-2-{((furan-2-yl)methyl)amino}pyrimidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-2-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid (CAS 2137822-79-6) is a chemical compound with the molecular formula C10H8BrN3O3 and a molecular weight of 298.09 g/mol. IUPAC name: 5-bromo-2-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid. InChIKey: QFDCTSCBVSOBFL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O3 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | 5-bromo-2-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid |
| InChIKey | QFDCTSCBVSOBFL-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=NC=C(C(=N2)C(=O)O)Br |
Computed by PubChem (NCBI)