Products 850375-34-7

CAS 850375-34-7 is the registry number for 3-(5-Bromo-pyridin-3-yl)-[1,2,4]oxadiazole-5-carboxylic acid ethyl ester, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-(5-bromo-3-pyridinyl)-1,2,4-oxadiazole-5-carboxylate (CAS 850375-34-7) is a chemical compound with the molecular formula C10H8BrN3O3 and a molecular weight of 298.09 g/mol. IUPAC name: ethyl 3-(5-bromo-3-pyridinyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: LSHJXSGSPMZMFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrN3O3
Molecular weight298.09 g/mol
IUPAC nameethyl 3-(5-bromo-3-pyridinyl)-1,2,4-oxadiazole-5-carboxylate
InChIKeyLSHJXSGSPMZMFQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=NO1)C2=CC(=CN=C2)Br

Computed by PubChem (NCBI)