CAS 954216-03-6 is the registry number for 5-Bromo-2-(furan-2-ylmethylamino)-3-nitropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
5-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine (CAS 954216-03-6) is a chemical compound with the molecular formula C10H8BrN3O3 and a molecular weight of 298.09 g/mol. IUPAC name: 5-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine. InChIKey: PGBJOWJPJLEDIJ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O3 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | 5-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine |
| InChIKey | PGBJOWJPJLEDIJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=C(C=C(C=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)