Products 2137837-24-0
CAS 2137837-24-0 is the registry number for 6-(tert-Butoxy)pyridine-3-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-[(2-methylpropan-2-yl)oxy]pyridine-3-sulfonyl fluoride (CAS 2137837-24-0) is a chemical compound with the molecular formula C9H12FNO3S and a molecular weight of 233.26 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxy]pyridine-3-sulfonyl fluoride. InChIKey: YQLZJKSARDUJJL-UHFFFAOYSA-N.
| Molecular formula | C9H12FNO3S |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxy]pyridine-3-sulfonyl fluoride |
| InChIKey | YQLZJKSARDUJJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=NC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)