Products 2140879-75-8
CAS 2140879-75-8 is the registry number for 2-Fluoro-5-(2-hydroxypropan-2-yl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-(2-hydroxypropan-2-yl)benzenesulfonamide (CAS 2140879-75-8) is a chemical compound with the molecular formula C9H12FNO3S and a molecular weight of 233.26 g/mol. IUPAC name: 2-fluoro-5-(2-hydroxypropan-2-yl)benzenesulfonamide. InChIKey: NLDAKDUFFOKNPG-UHFFFAOYSA-N.
| Molecular formula | C9H12FNO3S |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 2-fluoro-5-(2-hydroxypropan-2-yl)benzenesulfonamide |
| InChIKey | NLDAKDUFFOKNPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)F)S(=O)(=O)N)O |
Computed by PubChem (NCBI)