CAS 2387566-71-2 appears in our catalog under these names: (1S,2R)-2-Fluorocyclopropanamine benzenesulfonate, 97%, benzenesulfonic acid,(1S,2R)-2-fluorocyclopropanamine, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
Benzenesulfonic acid;cis-(1S,2R)-2-fluorocyclopropan-1-amine (CAS 2387566-71-2) is a chemical compound with the molecular formula C9H12FNO3S and a molecular weight of 233.26 g/mol. IUPAC name: benzenesulfonic acid;cis-(1S,2R)-2-fluorocyclopropan-1-amine. InChIKey: NPKPZDJVCNLRLC-RCROYASPSA-N.
| Molecular formula | C9H12FNO3S |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | benzenesulfonic acid;cis-(1S,2R)-2-fluorocyclopropan-1-amine |
| InChIKey | NPKPZDJVCNLRLC-RCROYASPSA-N |
| SMILES | C1[C@@H]([C@@H]1F)N.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)