CAS 2137994-15-9 is the registry number for rac-Methyl 1-((1R,2S)-2-aminocyclohexyl)-1H-1,2,3-triazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 1-[(1R,2S)-2-aminocyclohexyl]triazole-4-carboxylate;hydrochloride (CAS 2137994-15-9) is a chemical compound with the molecular formula C10H17ClN4O2 and a molecular weight of 260.72 g/mol. IUPAC name: methyl 1-[(1R,2S)-2-aminocyclohexyl]triazole-4-carboxylate;hydrochloride. InChIKey: PONHAZHQQZNTRE-DKXTVVGFSA-N.
| Molecular formula | C10H17ClN4O2 |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | methyl 1-[(1R,2S)-2-aminocyclohexyl]triazole-4-carboxylate;hydrochloride |
| InChIKey | PONHAZHQQZNTRE-DKXTVVGFSA-N |
| SMILES | COC(=O)C1=CN(N=N1)[C@@H]2CCCC[C@@H]2N.Cl |
Computed by PubChem (NCBI)