Products 2138573-41-6

CAS 2138573-41-6 is the registry number for Methyl 1-(azepan-4-yl)-1H-1,2,3-triazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 1-(azepan-4-yl)triazole-4-carboxylate;hydrochloride (CAS 2138573-41-6) is a chemical compound with the molecular formula C10H17ClN4O2 and a molecular weight of 260.72 g/mol. IUPAC name: methyl 1-(azepan-4-yl)triazole-4-carboxylate;hydrochloride. InChIKey: VMUIKVNJTJFSSK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17ClN4O2
Molecular weight260.72 g/mol
IUPAC namemethyl 1-(azepan-4-yl)triazole-4-carboxylate;hydrochloride
InChIKeyVMUIKVNJTJFSSK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN(N=N1)C2CCCNCC2.Cl

Computed by PubChem (NCBI)