CAS 2378490-24-3 is the registry number for (S)-6-(3-Aminopyrrolidin-1-yl)-3-ethylpyrimidine-2,4(1H,3H)-dione hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
6-[(3S)-3-aminopyrrolidin-1-yl]-3-ethyl-1H-pyrimidine-2,4-dione;hydrochloride (CAS 2378490-24-3) is a chemical compound with the molecular formula C10H17ClN4O2 and a molecular weight of 260.72 g/mol. IUPAC name: 6-[(3S)-3-aminopyrrolidin-1-yl]-3-ethyl-1H-pyrimidine-2,4-dione;hydrochloride. InChIKey: RREGVIJFDQWMQZ-FJXQXJEOSA-N.
| Molecular formula | C10H17ClN4O2 |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 6-[(3S)-3-aminopyrrolidin-1-yl]-3-ethyl-1H-pyrimidine-2,4-dione;hydrochloride |
| InChIKey | RREGVIJFDQWMQZ-FJXQXJEOSA-N |
| SMILES | CCN1C(=O)C=C(NC1=O)N2CC[C@@H](C2)N.Cl |
Computed by PubChem (NCBI)