Products 2138034-04-3
CAS 2138034-04-3 is the registry number for rac-(2R,3R)-1-((tert-Butoxy)carbonyl)-2-cyclopropylpiperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3S)-2-cyclopropyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 2138034-04-3) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: (2S,3S)-2-cyclopropyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: HVEGVUCDDCZOSN-QWRGUYRKSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | (2S,3S)-2-cyclopropyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | HVEGVUCDDCZOSN-QWRGUYRKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]([C@@H]1C2CC2)C(=O)O |
Computed by PubChem (NCBI)