Products 2138035-81-9
CAS 2138035-81-9 is the registry number for tert-Butyl 3-bromo-4-hydroxy-5,6,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-bromo-4-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate (CAS 2138035-81-9) is a chemical compound with the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. IUPAC name: tert-butyl 3-bromo-4-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate. InChIKey: SNCKVZLNPVTOJP-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O3 |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-4-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate |
| InChIKey | SNCKVZLNPVTOJP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=O)C(=CN2)Br |
Computed by PubChem (NCBI)