Products 2138100-38-4
CAS 2138100-38-4 is the registry number for 1-Methylazetidin-3-ol, oxalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-methylazetidin-3-ol;oxalic acid (CAS 2138100-38-4) is a chemical compound with the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. IUPAC name: 1-methylazetidin-3-ol;oxalic acid. InChIKey: YGYDIHLFHACJQY-UHFFFAOYSA-N.
| Molecular formula | C6H11NO5 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-methylazetidin-3-ol;oxalic acid |
| InChIKey | YGYDIHLFHACJQY-UHFFFAOYSA-N |
| SMILES | CN1CC(C1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)