Products 471242-80-5

CAS 471242-80-5 is the registry number for Dimethyl Hydroxyaspartate, Mixture of Diastereomers. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Dimethyl 2-amino-3-hydroxybutanedioate (CAS 471242-80-5) is a chemical compound with the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. IUPAC name: dimethyl 2-amino-3-hydroxybutanedioate. InChIKey: FKPFNKFGJIMFFG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO5
Molecular weight177.16 g/mol
IUPAC namedimethyl 2-amino-3-hydroxybutanedioate
InChIKeyFKPFNKFGJIMFFG-UHFFFAOYSA-N
SMILESCOC(=O)C(C(C(=O)OC)O)N

Computed by PubChem (NCBI)