CAS 746558-88-3 is the registry number for (2S,3S)-Dimethyl 2-amino-3-hydroxysuccinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (2S,3S)-2-amino-3-hydroxybutanedioate (CAS 746558-88-3) is a chemical compound with the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. IUPAC name: dimethyl (2S,3S)-2-amino-3-hydroxybutanedioate. InChIKey: FKPFNKFGJIMFFG-IMJSIDKUSA-N.
| Molecular formula | C6H11NO5 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | dimethyl (2S,3S)-2-amino-3-hydroxybutanedioate |
| InChIKey | FKPFNKFGJIMFFG-IMJSIDKUSA-N |
| SMILES | COC(=O)[C@H]([C@@H](C(=O)OC)O)N |
Computed by PubChem (NCBI)