Products 2138122-84-4
CAS 2138122-84-4 is the registry number for 6-((Quinolin-8-yl)methyl)-6-azaspiro(3.4)octane-5,7-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(quinolin-8-ylmethyl)-6-azaspiro[3.4]octane-5,7-dione (CAS 2138122-84-4) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 6-(quinolin-8-ylmethyl)-6-azaspiro[3.4]octane-5,7-dione. InChIKey: FVIQZBYSRXDQLV-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 6-(quinolin-8-ylmethyl)-6-azaspiro[3.4]octane-5,7-dione |
| InChIKey | FVIQZBYSRXDQLV-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(=O)N(C2=O)CC3=CC=CC4=C3N=CC=C4 |
Computed by PubChem (NCBI)