Products 2138156-00-8
CAS 2138156-00-8 is the registry number for rac-tert-Butyl (2R,5R)-5-(methylcarbamoyl)piperidine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (2R,5R)-5-(methylcarbamoyl)piperidine-2-carboxylate (CAS 2138156-00-8) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (2R,5R)-5-(methylcarbamoyl)piperidine-2-carboxylate. InChIKey: LSJRTQSZVVWHLJ-RKDXNWHRSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (2R,5R)-5-(methylcarbamoyl)piperidine-2-carboxylate |
| InChIKey | LSJRTQSZVVWHLJ-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC[C@H](CN1)C(=O)NC |
Computed by PubChem (NCBI)