Products 2138159-42-7

CAS 2138159-42-7 is the registry number for 2-Ethyl-3H-imidazo(4,5-b)pyridine-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-ethyl-1H-imidazo[4,5-b]pyridine-7-carboxylic acid;hydrochloride (CAS 2138159-42-7) is a chemical compound with the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. IUPAC name: 2-ethyl-1H-imidazo[4,5-b]pyridine-7-carboxylic acid;hydrochloride. InChIKey: LMHGBTNHJGJEAV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClN3O2
Molecular weight227.65 g/mol
IUPAC name2-ethyl-1H-imidazo[4,5-b]pyridine-7-carboxylic acid;hydrochloride
InChIKeyLMHGBTNHJGJEAV-UHFFFAOYSA-N
SMILESCCC1=NC2=NC=CC(=C2N1)C(=O)O.Cl

Computed by PubChem (NCBI)