Products 2138166-08-0
CAS 2138166-08-0 is the registry number for tert-Butyl N-{3-cyano-4H,5H,6H-cyclopenta(b)thiophen-2-yl}-N-methylcarbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-methylcarbamate (CAS 2138166-08-0) is a chemical compound with the molecular formula C14H18N2O2S and a molecular weight of 278.37 g/mol. IUPAC name: tert-butyl N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-methylcarbamate. InChIKey: FGGDDPHUWHPWMK-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2S |
|---|---|
| Molecular weight | 278.37 g/mol |
| IUPAC name | tert-butyl N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-N-methylcarbamate |
| InChIKey | FGGDDPHUWHPWMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=C(C2=C(S1)CCC2)C#N |
Computed by PubChem (NCBI)